C23H27N3O7 — CID 24773363
dimethyl (2R,6S)-1-[2-(2-hydroxyethoxy)ethyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate (PubChem CID 24773363) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is dimethyl (2R,6S)-1-[2-(2-hydroxyethoxy)ethyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2R,6S)-1-[2-(2-hydroxyethoxy)ethyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24773363 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | dimethyl (2R,6S)-1-[2-(2-hydroxyethoxy)ethyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(CCOCCO)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C23H27N3O7/c1-31-22(29)17-19(15-7-3-5-9-24-15)26(11-13-33-14-12-27)20(16-8-4-6-10-25-16)18(21(17)28)23(30)32-2/h3-10,17-20,27H,11-14H2,1-2H3/t17?,18?,19-,20+ |
| InChIKey | ASRYRKNQKDQFPJ-KHSMEXAKSA-N |
| XLogP | 0.73 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|