About ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine
ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine (PubChem CID 176680607) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine |
| PubChem CID | 176680607 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine |
| SMILES | CC.CCCN(C)C1=NC=C(C(C)C)CC1 |
| InChI | InChI=1S/C12H22N2.C2H6/c1-5-8-14(4)12-7-6-11(9-13-12)10(2)3;1-2/h9-10H,5-8H2,1-4H3;1-2H3 |
| InChIKey | BNCVWHYMWJELIV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine?
The IUPAC name of ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine (CID 176680607) is ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine?
The canonical SMILES for ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine is CC.CCCN(C)C1=NC=C(C(C)C)CC1.
What is the InChIKey of ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine?
The InChIKey is BNCVWHYMWJELIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.C2H6/c1-5-8-14(4)12-7-6-11(9-13-12)10(2)3;1-2/h9-10H,5-8H2,1-4H3;1-2H3.
What are the key properties of ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine?
ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine has a molecular weight of 224.39 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-5-propan-2-yl-N-propyl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 176680607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).