C24H30FN5O — CID 176712425
18-amino-7-(3-fluoro-3-methylazetidin-1-yl)-5-methoxy-14-methyl-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile (PubChem CID 176712425) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 18-amino-7-(3-fluoro-3-methylazetidin-1-yl)-5-methoxy-14-methyl-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile.
| Compound Name | 18-amino-7-(3-fluoro-3-methylazetidin-1-yl)-5-methoxy-14-methyl-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile |
|---|---|
| PubChem CID | 176712425 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 18-amino-7-(3-fluoro-3-methylazetidin-1-yl)-5-methoxy-14-methyl-4,6-diazatricyclo[13.4.0.03,8]nonadeca-1(15),3(8),4,6,16,18-hexaene-19-carbonitrile |
| SMILES | COc1nc2c(c(N3CC(C)(F)C3)n1)CCCCCC(C)c1ccc(N)c(C#N)c1C2 |
| InChI | InChI=1S/C24H30FN5O/c1-15-7-5-4-6-8-17-21(11-18-16(15)9-10-20(27)19(18)12-26)28-23(31-3)29-22(17)30-13-24(2,25)14-30/h9-10,15H,4-8,11,13-14,27H2,1-3H3 |
| InChIKey | CQWLVTRDPXBTFJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|