C28H31ClF2N6O3 — CID 176727345
2-[2-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4-hydroxy-4-methyldiazinan-1-yl]-1-phenylethanone (PubChem CID 176727345) has the molecular formula C28H31ClF2N6O3 and a molecular weight of 573.04 g/mol. Its IUPAC name is 2-[2-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4-hydroxy-4-methyldiazinan-1-yl]-1-phenylethanone.
| Compound Name | 2-[2-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4-hydroxy-4-methyldiazinan-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 176727345 |
| Molecular Formula | C28H31ClF2N6O3 |
| Molecular Weight | 573.04 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 2-[2-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4-hydroxy-4-methyldiazinan-1-yl]-1-phenylethanone |
| SMILES | CC1(O)CCN(CC(=O)c2ccccc2)N(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C28H31ClF2N6O3/c1-27(39)9-11-36(15-21(38)18-6-3-2-4-7-18)37(16-27)25-20-13-32-24(29)22(31)23(20)33-26(34-25)40-17-28-8-5-10-35(28)14-19(30)12-28/h2-4,6-7,13,19,39H,5,8-12,14-17H2,1H3/t19-,27?,28+/m1/s1 |
| InChIKey | ICFZWNYRZDARQH-WNUOQIARSA-N |
| XLogP | 3.83 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|