C14H29NO5S2 — CID 176734990
N-[2-(4-methyl-3-oxopentoxy)ethyl]-1-(2-propan-2-ylsulfanylethoxy)methanesulfonamide (PubChem CID 176734990) has the molecular formula C14H29NO5S2 and a molecular weight of 355.52 g/mol. Its IUPAC name is N-[2-(4-methyl-3-oxopentoxy)ethyl]-1-(2-propan-2-ylsulfanylethoxy)methanesulfonamide.
| Compound Name | N-[2-(4-methyl-3-oxopentoxy)ethyl]-1-(2-propan-2-ylsulfanylethoxy)methanesulfonamide |
|---|---|
| PubChem CID | 176734990 |
| Molecular Formula | C14H29NO5S2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[2-(4-methyl-3-oxopentoxy)ethyl]-1-(2-propan-2-ylsulfanylethoxy)methanesulfonamide |
| SMILES | CC(C)SCCOCS(=O)(=O)NCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C14H29NO5S2/c1-12(2)14(16)5-7-19-8-6-15-22(17,18)11-20-9-10-21-13(3)4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | MCPCXMUYEMOSHU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|