C12H27NO2 — CID 176738339
1-ethoxy-N,N-diethyl-3-propan-2-yloxypropan-2-amine (PubChem CID 176738339) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-ethoxy-N,N-diethyl-3-propan-2-yloxypropan-2-amine.
| Compound Name | 1-ethoxy-N,N-diethyl-3-propan-2-yloxypropan-2-amine |
|---|---|
| PubChem CID | 176738339 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-ethoxy-N,N-diethyl-3-propan-2-yloxypropan-2-amine |
| SMILES | CCOCC(COC(C)C)N(CC)CC |
| InChI | InChI=1S/C12H27NO2/c1-6-13(7-2)12(9-14-8-3)10-15-11(4)5/h11-12H,6-10H2,1-5H3 |
| InChIKey | YFCCRCIMFQMTMI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |