C33H22F2N4O3 — CID 176746993
3-[[2-(benzhydrylideneamino)-3-fluoro-4-pyridinyl]methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one (PubChem CID 176746993) has the molecular formula C33H22F2N4O3 and a molecular weight of 560.56 g/mol. Its IUPAC name is 3-[[2-(benzhydrylideneamino)-3-fluoro-4-pyridinyl]methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one.
| Compound Name | 3-[[2-(benzhydrylideneamino)-3-fluoro-4-pyridinyl]methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 176746993 |
| Molecular Formula | C33H22F2N4O3 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 3-[[2-(benzhydrylideneamino)-3-fluoro-4-pyridinyl]methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
| SMILES | Cc1c(Cc2ccnc(N=C(c3ccccc3)c3ccccc3)c2F)c(=O)oc2cc(Oc3ncccn3)cc(F)c12 |
| InChI | InChI=1S/C33H22F2N4O3/c1-20-25(32(40)42-27-19-24(18-26(34)28(20)27)41-33-37-14-8-15-38-33)17-23-13-16-36-31(29(23)35)39-30(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-16,18-19H,17H2,1H3 |
| InChIKey | SQFLRPYPHLUAAD-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|