C10H8N2O — CID 176758490
7-isocyano-4,6-dimethylfuro[3,2-c]pyridine (PubChem CID 176758490) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 7-isocyano-4,6-dimethylfuro[3,2-c]pyridine.
| Compound Name | 7-isocyano-4,6-dimethylfuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 176758490 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 7-isocyano-4,6-dimethylfuro[3,2-c]pyridine |
| SMILES | [C-]#[N+]c1c(C)nc(C)c2ccoc12 |
| InChI | InChI=1S/C10H8N2O/c1-6-8-4-5-13-10(8)9(11-3)7(2)12-6/h4-5H,1-2H3 |
| InChIKey | KRWXIEJOXLABTG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|