About dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate
dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate (PubChem CID 176759017) has the molecular formula C15H23K2NO5
and a molecular weight of 375.55 g/mol. Its IUPAC name is dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate.
Molecular Properties
| Compound Name | dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate |
| PubChem CID | 176759017 |
| Molecular Formula | C15H23K2NO5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate |
| SMILES | CN(C(=O)CCCC1CCCC1)C(CCC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C15H25NO5.2K/c1-16(12(15(20)21)9-10-14(18)19)13(17)8-4-7-11-5-2-3-6-11;;/h11-12H,2-10H2,1H3,(H,18,19)(H,20,21);;/q;2*+1/p-2 |
| InChIKey | PSTOMLJNLHBOED-UHFFFAOYSA-L |
| XLogP | -6.54 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | -6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate?
The IUPAC name of dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate (CID 176759017) is dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate.
What is the SMILES notation for dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate?
The canonical SMILES for dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate is CN(C(=O)CCCC1CCCC1)C(CCC(=O)[O-])C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate?
The InChIKey is PSTOMLJNLHBOED-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H25NO5.2K/c1-16(12(15(20)21)9-10-14(18)19)13(17)8-4-7-11-5-2-3-6-11;;/h11-12H,2-10H2,1H3,(H,18,19)(H,20,21);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate?
dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate has a molecular weight of 375.55 g/mol, XLogP of -6.54, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-[4-cyclopentylbutanoyl(methyl)amino]pentanedioate is sourced from PubChem (CID 176759017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).