C34H14F2N4O4 — CID 176771024
4-[2-(3,4-difluorophenyl)-13-(4-isocyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]benzonitrile (PubChem CID 176771024) has the molecular formula C34H14F2N4O4 and a molecular weight of 580.51 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)-13-(4-isocyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]benzonitrile.
| Compound Name | 4-[2-(3,4-difluorophenyl)-13-(4-isocyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]benzonitrile |
|---|---|
| PubChem CID | 176771024 |
| Molecular Formula | C34H14F2N4O4 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)-13-(4-isocyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)c3ccc4c5c(cc(-c6ccc(F)c(F)c6)c(c35)C2=O)C(=O)N(c2ccc(C#N)cc2)C4=O)cc1 |
| InChI | InChI=1S/C34H14F2N4O4/c1-38-19-5-9-21(10-6-19)40-32(42)23-12-11-22-28-25(33(43)39(31(22)41)20-7-2-17(16-37)3-8-20)15-24(30(29(23)28)34(40)44)18-4-13-26(35)27(36)14-18/h2-15H |
| InChIKey | LCTVLXKIQLDTMV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 102.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|