C21H18Cl2N3O2S- — CID 176786518
4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]-2,5-dichlorobenzenesulfinate (PubChem CID 176786518) has the molecular formula C21H18Cl2N3O2S- and a molecular weight of 447.37 g/mol. Its IUPAC name is 4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]-2,5-dichlorobenzenesulfinate.
| Compound Name | 4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]-2,5-dichlorobenzenesulfinate |
|---|---|
| PubChem CID | 176786518 |
| Molecular Formula | C21H18Cl2N3O2S- |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]-2,5-dichlorobenzenesulfinate |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2cc(Cl)c(S(=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O2S/c1-2-26(14-15-6-4-3-5-7-15)17-10-8-16(9-11-17)24-25-20-12-19(23)21(29(27)28)13-18(20)22/h3-13H,2,14H2,1H3,(H,27,28)/p-1/b25-24+ |
| InChIKey | ZDYJRLZNLUAWPY-OCOZRVBESA-M |
| XLogP | 6.67 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|