C20H28N6O4S — CID 90474907
N-benzyl-4-[(1,2-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylaniline;methyl sulfate (PubChem CID 90474907) has the molecular formula C20H28N6O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-benzyl-4-[(1,2-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylaniline;methyl sulfate.
| Compound Name | N-benzyl-4-[(1,2-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylaniline;methyl sulfate |
|---|---|
| PubChem CID | 90474907 |
| Molecular Formula | C20H28N6O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-benzyl-4-[(1,2-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylaniline;methyl sulfate |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/C2=NC[NH+](C)N2C)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H24N6.CH4O4S/c1-4-25(14-16-8-6-5-7-9-16)18-12-10-17(11-13-18)21-22-19-20-15-23(2)24(19)3;1-5-6(2,3)4/h5-13H,4,14-15H2,1-3H3;1H3,(H,2,3,4)/b22-21+; |
| InChIKey | KBKCGOUYTMTSJB-QUABFQRHSA-N |
| XLogP | 1.58 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|