C27H34N6O4S — CID 25076581
4-[(1-benzyl-4-methyl-5-phenyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N,N-diethylaniline;methyl sulfate (PubChem CID 25076581) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 4-[(1-benzyl-4-methyl-5-phenyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N,N-diethylaniline;methyl sulfate.
| Compound Name | 4-[(1-benzyl-4-methyl-5-phenyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N,N-diethylaniline;methyl sulfate |
|---|---|
| PubChem CID | 25076581 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 4-[(1-benzyl-4-methyl-5-phenyl-1,5-dihydro-1,2,4-triazol-1-ium-3-yl)diazenyl]-N,N-diethylaniline;methyl sulfate |
| SMILES | CCN(CC)c1ccc(/N=N/C2=N[NH+](Cc3ccccc3)C(c3ccccc3)N2C)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C26H30N6.CH4O4S/c1-4-31(5-2)24-18-16-23(17-19-24)27-28-26-29-32(20-21-12-8-6-9-13-21)25(30(26)3)22-14-10-7-11-15-22;1-5-6(2,3)4/h6-19,25H,4-5,20H2,1-3H3;1H3,(H,2,3,4)/b28-27+; |
| InChIKey | TXBYCIQJWGLANG-RXQWRGDBSA-N |
| XLogP | 3.71 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|