About ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate
ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate (PubChem CID 176787158) has the molecular formula C10H13BrF2N2O3S
and a molecular weight of 359.19 g/mol. Its IUPAC name is ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate |
| PubChem CID | 176787158 |
| Molecular Formula | C10H13BrF2N2O3S |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate |
| SMILES | CCOC(=O)CCOC(c1nc(Br)cs1)C(N)(F)F |
| InChI | InChI=1S/C10H13BrF2N2O3S/c1-2-17-7(16)3-4-18-8(10(12,13)14)9-15-6(11)5-19-9/h5,8H,2-4,14H2,1H3 |
| InChIKey | LCXPVINBNPIWGY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate?
The IUPAC name of ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate (CID 176787158) is ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate.
What is the SMILES notation for ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate?
The canonical SMILES for ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate is CCOC(=O)CCOC(c1nc(Br)cs1)C(N)(F)F.
What is the InChIKey of ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate?
The InChIKey is LCXPVINBNPIWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrF2N2O3S/c1-2-17-7(16)3-4-18-8(10(12,13)14)9-15-6(11)5-19-9/h5,8H,2-4,14H2,1H3.
What are the key properties of ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate?
ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate has a molecular weight of 359.19 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-amino-1-(4-bromo-1,3-thiazol-2-yl)-2,2-difluoroethoxy]propanoate is sourced from PubChem (CID 176787158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).