C27H32N3O3+ — CID 176792416
16-(4-butylpiperazin-1-yl)-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 176792416) has the molecular formula C27H32N3O3+ and a molecular weight of 446.57 g/mol. Its IUPAC name is 16-(4-butylpiperazin-1-yl)-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16-(4-butylpiperazin-1-yl)-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 176792416 |
| Molecular Formula | C27H32N3O3+ |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 16-(4-butylpiperazin-1-yl)-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | CCCCN1CCN(c2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)CC1 |
| InChI | InChI=1S/C27H32N3O3/c1-3-4-8-28-10-12-29(13-11-28)27-22-17-30-9-7-20-15-25-26(33-18-32-25)16-21(20)23(30)14-19(22)5-6-24(27)31-2/h5-6,14-17H,3-4,7-13,18H2,1-2H3/q+1 |
| InChIKey | CFUWRCHYXRVMIS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|