C19H38O3S — CID 176795428
2,2,6,6,8,8-hexamethyl-5-(propan-2-ylsulfonylmethyl)nonan-3-one (PubChem CID 176795428) has the molecular formula C19H38O3S and a molecular weight of 346.58 g/mol. Its IUPAC name is 2,2,6,6,8,8-hexamethyl-5-(propan-2-ylsulfonylmethyl)nonan-3-one.
| Compound Name | 2,2,6,6,8,8-hexamethyl-5-(propan-2-ylsulfonylmethyl)nonan-3-one |
|---|---|
| PubChem CID | 176795428 |
| Molecular Formula | C19H38O3S |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2,2,6,6,8,8-hexamethyl-5-(propan-2-ylsulfonylmethyl)nonan-3-one |
| SMILES | CC(C)S(=O)(=O)CC(CC(=O)C(C)(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C19H38O3S/c1-14(2)23(21,22)12-15(11-16(20)18(6,7)8)19(9,10)13-17(3,4)5/h14-15H,11-13H2,1-10H3 |
| InChIKey | QEKRQUKIUZVUHZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |