C35H46N3O6+ — CID 176801785
5-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanamide (PubChem CID 176801785) has the molecular formula C35H46N3O6+ and a molecular weight of 604.77 g/mol. Its IUPAC name is 5-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanamide.
| Compound Name | 5-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanamide |
|---|---|
| PubChem CID | 176801785 |
| Molecular Formula | C35H46N3O6+ |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | 5-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanamide |
| SMILES | C[N+]1=C(/C=C/C=C2/N(CCCCC(=O)N[C@H]3C(O)O[C@H](CO)[C@@H](O)[C@@H]3O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H45N3O6/c1-34(2)22-13-6-8-15-24(22)37(5)27(34)17-12-18-28-35(3,4)23-14-7-9-16-25(23)38(28)20-11-10-19-29(40)36-30-32(42)31(41)26(21-39)44-33(30)43/h6-9,12-18,26,30-33,39,41-43H,10-11,19-21H2,1-5H3/p+1/t26-,30-,31-,32-,33?/m1/s1 |
| InChIKey | BAWDUIRKMHORMF-CRVWWWDQSA-O |
| XLogP | 3.02 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|