C31H21BNOSeTe+ — CID 176802303
1-methyl-2-(9-methyl-12-oxa-15-selena-21-tellura-1-boraheptacyclo[14.11.1.02,14.05,13.06,11.020,28.022,27]octacosa-2(14),3,5(13),6(11),7,9,16(28),17,19,22,24,26-dodecaen-10-yl)pyridin-1-ium (PubChem CID 176802303) has the molecular formula C31H21BNOSeTe+ and a molecular weight of 640.89 g/mol. Its IUPAC name is 1-methyl-2-(9-methyl-12-oxa-15-selena-21-tellura-1-boraheptacyclo[14.11.1.02,14.05,13.06,11.020,28.022,27]octacosa-2(14),3,5(13),6(11),7,9,16(28),17,19,22,24,26-dodecaen-10-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(9-methyl-12-oxa-15-selena-21-tellura-1-boraheptacyclo[14.11.1.02,14.05,13.06,11.020,28.022,27]octacosa-2(14),3,5(13),6(11),7,9,16(28),17,19,22,24,26-dodecaen-10-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 176802303 |
| Molecular Formula | C31H21BNOSeTe+ |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 643.99 |
| IUPAC Name | 1-methyl-2-(9-methyl-12-oxa-15-selena-21-tellura-1-boraheptacyclo[14.11.1.02,14.05,13.06,11.020,28.022,27]octacosa-2(14),3,5(13),6(11),7,9,16(28),17,19,22,24,26-dodecaen-10-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c4c(ccc32)B2c3ccccc3[Te]c3cccc(c32)[Se]4)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C31H21BNOSeTe/c1-18-13-14-19-20-15-16-22-31(30(20)34-29(19)27(18)23-9-5-6-17-33(23)2)35-24-10-7-12-26-28(24)32(22)21-8-3-4-11-25(21)36-26/h3-17H,1-2H3/q+1 |
| InChIKey | VAHOTQWCKHDBPU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|