C29H27N3 — CID 176812474
4,4,6,6,16,22-hexamethyl-1,12,23-triazaheptacyclo[12.10.1.12,9.03,7.018,25.019,24.013,26]hexacosa-2(26),3(7),8,10,12,14,16,18(25),19(24),20,22-undecaene (PubChem CID 176812474) has the molecular formula C29H27N3 and a molecular weight of 417.56 g/mol. Its IUPAC name is 4,4,6,6,16,22-hexamethyl-1,12,23-triazaheptacyclo[12.10.1.12,9.03,7.018,25.019,24.013,26]hexacosa-2(26),3(7),8,10,12,14,16,18(25),19(24),20,22-undecaene.
| Compound Name | 4,4,6,6,16,22-hexamethyl-1,12,23-triazaheptacyclo[12.10.1.12,9.03,7.018,25.019,24.013,26]hexacosa-2(26),3(7),8,10,12,14,16,18(25),19(24),20,22-undecaene |
|---|---|
| PubChem CID | 176812474 |
| Molecular Formula | C29H27N3 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4,4,6,6,16,22-hexamethyl-1,12,23-triazaheptacyclo[12.10.1.12,9.03,7.018,25.019,24.013,26]hexacosa-2(26),3(7),8,10,12,14,16,18(25),19(24),20,22-undecaene |
| SMILES | Cc1cc2c3ccc(C)nc3n3c4c5c(cc6ccnc(c(c1)c23)c64)C(C)(C)CC5(C)C |
| InChI | InChI=1S/C29H27N3/c1-15-11-19-18-8-7-16(2)31-27(18)32-25(19)20(12-15)24-22-17(9-10-30-24)13-21-23(26(22)32)29(5,6)14-28(21,3)4/h7-13H,14H2,1-6H3 |
| InChIKey | ZSXFXXZCNSJZPI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|