C24H39F3N2O4 — CID 176815926
N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 176815926) has the molecular formula C24H39F3N2O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 176815926 |
| Molecular Formula | C24H39F3N2O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCOC[C@H]1OC[C@H](Nc2cc(C(F)(F)F)ccn2)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C24H39F3N2O4/c1-4-7-12-30-17-20-23(32-14-9-6-3)22(31-13-8-5-2)19(16-33-20)29-21-15-18(10-11-28-21)24(25,26)27/h10-11,15,19-20,22-23H,4-9,12-14,16-17H2,1-3H3,(H,28,29)/t19-,20+,22+,23-/m0/s1 |
| InChIKey | DXIXXZWGEPMVNH-JVSAHFFESA-N |
| XLogP | 5.47 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|