C29H25N2O+ — CID 176823676
7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-5-(trideuteriomethyl)-10-oxa-6-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene (PubChem CID 176823676) has the molecular formula C29H25N2O+ and a molecular weight of 426.59 g/mol. Its IUPAC name is 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-5-(trideuteriomethyl)-10-oxa-6-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene.
| Compound Name | 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-5-(trideuteriomethyl)-10-oxa-6-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176823676 |
| Molecular Formula | C29H25N2O+ |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-5-(trideuteriomethyl)-10-oxa-6-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c(C)nc(C([2H])([2H])[2H])c3c2oc2cc4ccc5ccccc5c4cc23)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C29H25N2O/c1-16-12-25(31(5)15-17(16)2)28-19(4)30-18(3)27-24-14-23-21(13-26(24)32-29(27)28)11-10-20-8-6-7-9-22(20)23/h6-15H,1-5H3/q+1/i1D3,2D3,3D3 |
| InChIKey | KTAVAVVQNPXVTK-GQALSZNTSA-N |
| XLogP | 7.01 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|