C23H26N2O2 — CID 176842300
(6aR)-5-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-phenyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 176842300) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (6aR)-5-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-phenyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (6aR)-5-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-phenyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 176842300 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (6aR)-5-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-phenyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1C[C@@H]2COCC2C1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c1-15-10-21(26-2)19(18-8-9-24-22(15)18)12-25-11-17-13-27-14-20(17)23(25)16-6-4-3-5-7-16/h3-10,17,20,23-24H,11-14H2,1-2H3/t17-,20?,23?/m1/s1 |
| InChIKey | YCQBUAKCJBVBTL-WMAFBANVSA-N |
| XLogP | 4.30 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |