C45H28N6S2 — CID 176869700
N-[dibenzothiophen-4-yl-[[3-(1-pyridin-4-ylindazol-3-yl)phenyl]methylideneamino]methylidene]dibenzothiophene-4-carboximidamide (PubChem CID 176869700) has the molecular formula C45H28N6S2 and a molecular weight of 716.90 g/mol. Its IUPAC name is N-[dibenzothiophen-4-yl-[[3-(1-pyridin-4-ylindazol-3-yl)phenyl]methylideneamino]methylidene]dibenzothiophene-4-carboximidamide.
| Compound Name | N-[dibenzothiophen-4-yl-[[3-(1-pyridin-4-ylindazol-3-yl)phenyl]methylideneamino]methylidene]dibenzothiophene-4-carboximidamide |
|---|---|
| PubChem CID | 176869700 |
| Molecular Formula | C45H28N6S2 |
| Molecular Weight | 716.90 g/mol |
| Exact Mass | 716.18 |
| IUPAC Name | N-[dibenzothiophen-4-yl-[[3-(1-pyridin-4-ylindazol-3-yl)phenyl]methylideneamino]methylidene]dibenzothiophene-4-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cccc(-c2nn(-c3ccncc3)c3ccccc23)c1)c1cccc2c1sc1ccccc12)c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C45H28N6S2/c46-44(36-17-8-15-33-31-12-2-5-20-39(31)52-42(33)36)49-45(37-18-9-16-34-32-13-3-6-21-40(32)53-43(34)37)48-27-28-10-7-11-29(26-28)41-35-14-1-4-19-38(35)51(50-41)30-22-24-47-25-23-30/h1-27,46H/b46-44+,48-27+,49-45+ |
| InChIKey | QZIUDJBFIOTAON-KCQHTIAUSA-N |
| XLogP | 11.71 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.90 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|