C42H85N3O5+2 — CID 176872402
[6-azaniumyl-1-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-1-oxohexan-2-yl]azanium (PubChem CID 176872402) has the molecular formula C42H85N3O5+2 and a molecular weight of 712.16 g/mol. Its IUPAC name is [6-azaniumyl-1-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-1-oxohexan-2-yl]azanium.
| Compound Name | [6-azaniumyl-1-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-1-oxohexan-2-yl]azanium |
|---|---|
| PubChem CID | 176872402 |
| Molecular Formula | C42H85N3O5+2 |
| Molecular Weight | 712.16 g/mol |
| Exact Mass | 711.65 |
| IUPAC Name | [6-azaniumyl-1-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-1-oxohexan-2-yl]azanium |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)C([NH3+])CCCC[NH3+] |
| InChI | InChI=1S/C42H83N3O5/c1-5-9-13-17-19-23-29-37(27-21-15-11-7-3)41(47)49-35-33-45(40(46)39(44)31-25-26-32-43)34-36-50-42(48)38(28-22-16-12-8-4)30-24-20-18-14-10-6-2/h37-39H,5-36,43-44H2,1-4H3/p+2 |
| InChIKey | RKOJNOHOSZMXHE-UHFFFAOYSA-P |
| XLogP | 8.60 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.16 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|