C41H80N2O5 — CID 176950544
2-[2-(ethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate (PubChem CID 176950544) has the molecular formula C41H80N2O5 and a molecular weight of 681.10 g/mol. Its IUPAC name is 2-[2-(ethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate.
| Compound Name | 2-[2-(ethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 176950544 |
| Molecular Formula | C41H80N2O5 |
| Molecular Weight | 681.10 g/mol |
| Exact Mass | 680.61 |
| IUPAC Name | 2-[2-(ethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)C(C)NCC |
| InChI | InChI=1S/C41H80N2O5/c1-7-12-16-20-22-26-30-37(28-24-18-14-9-3)40(45)47-34-32-43(39(44)36(6)42-11-5)33-35-48-41(46)38(29-25-19-15-10-4)31-27-23-21-17-13-8-2/h36-38,42H,7-35H2,1-6H3 |
| InChIKey | MIFCUXDJULYJJP-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.10 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|