C43H84N2O5 — CID 176872494
2-[2-(diethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate (PubChem CID 176872494) has the molecular formula C43H84N2O5 and a molecular weight of 709.15 g/mol. Its IUPAC name is 2-[2-(diethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate.
| Compound Name | 2-[2-(diethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 176872494 |
| Molecular Formula | C43H84N2O5 |
| Molecular Weight | 709.15 g/mol |
| Exact Mass | 708.64 |
| IUPAC Name | 2-[2-(diethylamino)propanoyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)C(C)N(CC)CC |
| InChI | InChI=1S/C43H84N2O5/c1-8-14-18-22-24-28-32-39(30-26-20-16-10-3)42(47)49-36-34-45(41(46)38(7)44(12-5)13-6)35-37-50-43(48)40(31-27-21-17-11-4)33-29-25-23-19-15-9-2/h38-40H,8-37H2,1-7H3 |
| InChIKey | GMHMDWBUBUFHNN-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.15 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|