C54H107N2O5+ — CID 176950493
[3-[bis[2-(2-nonylundecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-dipropylazanium (PubChem CID 176950493) has the molecular formula C54H107N2O5+ and a molecular weight of 864.46 g/mol. Its IUPAC name is [3-[bis[2-(2-nonylundecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-dipropylazanium.
| Compound Name | [3-[bis[2-(2-nonylundecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-dipropylazanium |
|---|---|
| PubChem CID | 176950493 |
| Molecular Formula | C54H107N2O5+ |
| Molecular Weight | 864.46 g/mol |
| Exact Mass | 863.82 |
| IUPAC Name | [3-[bis[2-(2-nonylundecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-dipropylazanium |
| SMILES | CCCCCCCCCC(CCCCCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCCCCC)CCCCCCCCC)C(=O)C(C)C[NH+](CCC)CCC |
| InChI | InChI=1S/C54H106N2O5/c1-8-14-18-22-26-30-34-38-50(39-35-31-27-23-19-15-9-2)53(58)60-46-44-56(52(57)49(7)48-55(42-12-5)43-13-6)45-47-61-54(59)51(40-36-32-28-24-20-16-10-3)41-37-33-29-25-21-17-11-4/h49-51H,8-48H2,1-7H3/p+1 |
| InChIKey | MYZVKFQQUBLOCZ-UHFFFAOYSA-O |
| XLogP | 14.04 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.46 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|