C42H83N2O5+ — CID 176872454
[3-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-ethylazanium (PubChem CID 176872454) has the molecular formula C42H83N2O5+ and a molecular weight of 696.13 g/mol. Its IUPAC name is [3-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-ethylazanium.
| Compound Name | [3-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-ethylazanium |
|---|---|
| PubChem CID | 176872454 |
| Molecular Formula | C42H83N2O5+ |
| Molecular Weight | 696.13 g/mol |
| Exact Mass | 695.63 |
| IUPAC Name | [3-[bis[2-(2-hexyldecanoyloxy)ethyl]amino]-2-methyl-3-oxopropyl]-ethylazanium |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)C(C)C[NH2+]CC |
| InChI | InChI=1S/C42H82N2O5/c1-7-12-16-20-22-26-30-38(28-24-18-14-9-3)41(46)48-34-32-44(40(45)37(6)36-43-11-5)33-35-49-42(47)39(29-25-19-15-10-4)31-27-23-21-17-13-8-2/h37-39,43H,7-36H2,1-6H3/p+1 |
| InChIKey | NKECVKBUFQCSRV-UHFFFAOYSA-O |
| XLogP | 9.80 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.13 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|