C16H27Cl3N4O4S — CID 176883444
2-[2-[(2-chloroacetyl)amino]ethylsulfanyl]-N,N-bis[3-[(2-chloroacetyl)amino]propyl]acetamide (PubChem CID 176883444) has the molecular formula C16H27Cl3N4O4S and a molecular weight of 477.84 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]ethylsulfanyl]-N,N-bis[3-[(2-chloroacetyl)amino]propyl]acetamide.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]ethylsulfanyl]-N,N-bis[3-[(2-chloroacetyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 176883444 |
| Molecular Formula | C16H27Cl3N4O4S |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]ethylsulfanyl]-N,N-bis[3-[(2-chloroacetyl)amino]propyl]acetamide |
| SMILES | O=C(CCl)NCCCN(CCCNC(=O)CCl)C(=O)CSCCNC(=O)CCl |
| InChI | InChI=1S/C16H27Cl3N4O4S/c17-9-13(24)20-3-1-6-23(7-2-4-21-14(25)10-18)16(27)12-28-8-5-22-15(26)11-19/h1-12H2,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | SNYSVFPMFLUKRT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|