C27H36BrNO3 — CID 176884477
5-bromo-3-tert-butyl-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-hydroxy-6-methylbenzamide (PubChem CID 176884477) has the molecular formula C27H36BrNO3 and a molecular weight of 502.49 g/mol. Its IUPAC name is 5-bromo-3-tert-butyl-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-hydroxy-6-methylbenzamide.
| Compound Name | 5-bromo-3-tert-butyl-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-hydroxy-6-methylbenzamide |
|---|---|
| PubChem CID | 176884477 |
| Molecular Formula | C27H36BrNO3 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 5-bromo-3-tert-butyl-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-hydroxy-6-methylbenzamide |
| SMILES | Cc1c(Br)cc(C(C)(C)C)c(O)c1C(=O)/N=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36BrNO3/c1-15-20(28)13-19(27(8,9)10)23(31)21(15)24(32)29-14-16-11-17(25(2,3)4)22(30)18(12-16)26(5,6)7/h11-14,30-31H,1-10H3/b29-14+ |
| InChIKey | BUUFNPYLRGIVOI-IPPBACCNSA-N |
| XLogP | 7.32 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|