C20H20O2 — CID 176899213
tert-butyl (11E,13Z)-tricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8,11,13-heptaene-11-carboxylate (PubChem CID 176899213) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl (11E,13Z)-tricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8,11,13-heptaene-11-carboxylate.
| Compound Name | tert-butyl (11E,13Z)-tricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8,11,13-heptaene-11-carboxylate |
|---|---|
| PubChem CID | 176899213 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl (11E,13Z)-tricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8,11,13-heptaene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)/C1=C/C=C\c2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C20H20O2/c1-20(2,3)22-19(21)17-12-6-10-15-8-4-7-14-9-5-11-16(13-17)18(14)15/h4-12H,13H2,1-3H3/b10-6-,17-12+ |
| InChIKey | REGQZIGXQPMLMQ-LROUVQFUSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |