C14H19BO2P — CID 176900268
CID 176900268 (PubChem CID 176900268) has the molecular formula C14H19BO2P and a molecular weight of 261.09 g/mol.
| Compound Name | CID 176900268 |
|---|---|
| PubChem CID | 176900268 |
| Molecular Formula | C14H19BO2P |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[B]Pc1c2c(cc3c1OCC3)CCO2 |
| InChI | InChI=1S/C14H19BO2P/c1-14(2,3)15-18-13-11-9(4-6-16-11)8-10-5-7-17-12(10)13/h8,18H,4-7H2,1-3H3 |
| InChIKey | MLIZQQVKIPFSJR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|