C25H24F4N4O6S — CID 176900357
1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]urea (PubChem CID 176900357) has the molecular formula C25H24F4N4O6S and a molecular weight of 584.55 g/mol. Its IUPAC name is 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 176900357 |
| Molecular Formula | C25H24F4N4O6S |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)c(F)c1)NC1CCC(Nc2c(NS(=O)(=O)Cc3ccccc3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C25H24F4N4O6S/c26-18-12-17(10-11-19(18)39-25(27,28)29)32-24(36)31-16-8-6-15(7-9-16)30-20-21(23(35)22(20)34)33-40(37,38)13-14-4-2-1-3-5-14/h1-5,10-12,15-16,30,33H,6-9,13H2,(H2,31,32,36) |
| InChIKey | KBDIJOZJLDLVSR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|