C25H27FN4O5S — CID 176900348
1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-(3-fluoro-4-methylphenyl)urea (PubChem CID 176900348) has the molecular formula C25H27FN4O5S and a molecular weight of 514.58 g/mol. Its IUPAC name is 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-(3-fluoro-4-methylphenyl)urea.
| Compound Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-(3-fluoro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 176900348 |
| Molecular Formula | C25H27FN4O5S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-(3-fluoro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CCC(Nc3c(NS(=O)(=O)Cc4ccccc4)c(=O)c3=O)CC2)cc1F |
| InChI | InChI=1S/C25H27FN4O5S/c1-15-7-8-19(13-20(15)26)29-25(33)28-18-11-9-17(10-12-18)27-21-22(24(32)23(21)31)30-36(34,35)14-16-5-3-2-4-6-16/h2-8,13,17-18,27,30H,9-12,14H2,1H3,(H2,28,29,33) |
| InChIKey | ITMWAJOOBPOROZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|