C18H38N2O5 — CID 176901148
1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate (PubChem CID 176901148) has the molecular formula C18H38N2O5 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate.
| Compound Name | 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176901148 |
| Molecular Formula | C18H38N2O5 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
| SMILES | CN(C)CCOCCNC(=O)OC(CCCCCO)CCCCCO |
| InChI | InChI=1S/C18H38N2O5/c1-20(2)12-16-24-15-11-19-18(23)25-17(9-5-3-7-13-21)10-6-4-8-14-22/h17,21-22H,3-16H2,1-2H3,(H,19,23) |
| InChIKey | SPMNJGKPFHZMRD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|