About 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate
1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate (PubChem CID 176901148) has the molecular formula C18H38N2O5
and a molecular weight of 362.51 g/mol. Its IUPAC name is 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate.
Molecular Properties
| Compound Name | 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
| PubChem CID | 176901148 |
| Molecular Formula | C18H38N2O5 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
| SMILES | CN(C)CCOCCNC(=O)OC(CCCCCO)CCCCCO |
| InChI | InChI=1S/C18H38N2O5/c1-20(2)12-16-24-15-11-19-18(23)25-17(9-5-3-7-13-21)10-6-4-8-14-22/h17,21-22H,3-16H2,1-2H3,(H,19,23) |
| InChIKey | SPMNJGKPFHZMRD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate?
The IUPAC name of 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate (CID 176901148) is 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate.
What is the SMILES notation for 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate?
The canonical SMILES for 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate is CN(C)CCOCCNC(=O)OC(CCCCCO)CCCCCO.
What is the InChIKey of 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate?
The InChIKey is SPMNJGKPFHZMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O5/c1-20(2)12-16-24-15-11-19-18(23)25-17(9-5-3-7-13-21)10-6-4-8-14-22/h17,21-22H,3-16H2,1-2H3,(H,19,23).
What are the key properties of 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate?
1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate has a molecular weight of 362.51 g/mol, XLogP of 1.76, 17 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,11-dihydroxyundecan-6-yl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate is sourced from PubChem (CID 176901148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).