C21H14ClN3O3 — CID 176914447
2-(5-chloro-2-hydroxyphenyl)-4-[(3-pyridin-3-yloxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 176914447) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxyphenyl)-4-[(3-pyridin-3-yloxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | 2-(5-chloro-2-hydroxyphenyl)-4-[(3-pyridin-3-yloxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 176914447 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-(5-chloro-2-hydroxyphenyl)-4-[(3-pyridin-3-yloxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | O=C1NC(c2cc(Cl)ccc2O)=NC1=Cc1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C21H14ClN3O3/c22-14-6-7-19(26)17(11-14)20-24-18(21(27)25-20)10-13-3-1-4-15(9-13)28-16-5-2-8-23-12-16/h1-12,26H,(H,24,25,27) |
| InChIKey | VIYKGRIOELGBPB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|