C22H22F5N3O4S — CID 176914532
(2R,3S,4S,5R)-N-[2-(3,3-difluoroazetidine-1-carbonyl)-4-pyridinyl]-3-(4-methoxythiophen-3-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 176914532) has the molecular formula C22H22F5N3O4S and a molecular weight of 519.49 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-(3,3-difluoroazetidine-1-carbonyl)-4-pyridinyl]-3-(4-methoxythiophen-3-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-(3,3-difluoroazetidine-1-carbonyl)-4-pyridinyl]-3-(4-methoxythiophen-3-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 176914532 |
| Molecular Formula | C22H22F5N3O4S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-(3,3-difluoroazetidine-1-carbonyl)-4-pyridinyl]-3-(4-methoxythiophen-3-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1cscc1[C@H]1[C@H](C(=O)Nc2ccnc(C(=O)N3CC(F)(F)C3)c2)O[C@@](C)(C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C22H22F5N3O4S/c1-11-16(13-7-35-8-15(13)33-3)17(34-20(11,2)22(25,26)27)18(31)29-12-4-5-28-14(6-12)19(32)30-9-21(23,24)10-30/h4-8,11,16-17H,9-10H2,1-3H3,(H,28,29,31)/t11-,16-,17+,20+/m0/s1 |
| InChIKey | VLBVRJYUODLWEQ-LKASSIKMSA-N |
| XLogP | 4.32 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |