About 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide
3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide (PubChem CID 176934186) has the molecular formula C12H13FN2O
and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide |
| PubChem CID | 176934186 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(C)C)cc2c1F |
| InChI | InChI=1S/C12H13FN2O/c1-7-11(13)9-6-8(12(16)15(2)3)4-5-10(9)14-7/h4-6,14H,1-3H3 |
| InChIKey | QQZIPJORJSSGQV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide?
The IUPAC name of 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide (CID 176934186) is 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide.
What is the SMILES notation for 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide?
The canonical SMILES for 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide is Cc1[nH]c2ccc(C(=O)N(C)C)cc2c1F.
What is the InChIKey of 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide?
The InChIKey is QQZIPJORJSSGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O/c1-7-11(13)9-6-8(12(16)15(2)3)4-5-10(9)14-7/h4-6,14H,1-3H3.
What are the key properties of 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide?
3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide has a molecular weight of 220.25 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide is sourced from PubChem (CID 176934186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).