C12H13FN2O — CID 176934186
3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide (PubChem CID 176934186) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide.
| Compound Name | 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 176934186 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-fluoro-N,N,2-trimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(C)C)cc2c1F |
| InChI | InChI=1S/C12H13FN2O/c1-7-11(13)9-6-8(12(16)15(2)3)4-5-10(9)14-7/h4-6,14H,1-3H3 |
| InChIKey | QQZIPJORJSSGQV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |