C11H13ClN6O2 — CID 176946824
2-[1-(3-chloro-1,2,4-triazole-4-carbonyl)-4-(2-oxoethyl)piperazin-2-yl]acetonitrile (PubChem CID 176946824) has the molecular formula C11H13ClN6O2 and a molecular weight of 296.72 g/mol. Its IUPAC name is 2-[1-(3-chloro-1,2,4-triazole-4-carbonyl)-4-(2-oxoethyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[1-(3-chloro-1,2,4-triazole-4-carbonyl)-4-(2-oxoethyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 176946824 |
| Molecular Formula | C11H13ClN6O2 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-[1-(3-chloro-1,2,4-triazole-4-carbonyl)-4-(2-oxoethyl)piperazin-2-yl]acetonitrile |
| SMILES | N#CCC1CN(CC=O)CCN1C(=O)n1cnnc1Cl |
| InChI | InChI=1S/C11H13ClN6O2/c12-10-15-14-8-18(10)11(20)17-4-3-16(5-6-19)7-9(17)1-2-13/h6,8-9H,1,3-5,7H2 |
| InChIKey | DSKQGWCZQATXDB-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 95.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|