C16H15F3O — CID 176951772
ethane;4-ethyl-5-ethynyl-6,7,8-trifluoronaphthalen-2-ol (PubChem CID 176951772) has the molecular formula C16H15F3O and a molecular weight of 280.29 g/mol. Its IUPAC name is ethane;4-ethyl-5-ethynyl-6,7,8-trifluoronaphthalen-2-ol.
| Compound Name | ethane;4-ethyl-5-ethynyl-6,7,8-trifluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 176951772 |
| Molecular Formula | C16H15F3O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | ethane;4-ethyl-5-ethynyl-6,7,8-trifluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)c(F)c(F)c2cc(O)cc(CC)c12.CC |
| InChI | InChI=1S/C14H9F3O.C2H6/c1-3-7-5-8(18)6-10-11(7)9(4-2)12(15)14(17)13(10)16;1-2/h2,5-6,18H,3H2,1H3;1-2H3 |
| InChIKey | PPQXSUJHTIOKAZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|