C24H30N2O9 — CID 176952264
tert-butyl [(3S,4S,5R)-5-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]-4-(4-nitrophenoxy)carbonyloxypyrrolidin-3-yl] carbonate (PubChem CID 176952264) has the molecular formula C24H30N2O9 and a molecular weight of 490.51 g/mol. Its IUPAC name is tert-butyl [(3S,4S,5R)-5-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]-4-(4-nitrophenoxy)carbonyloxypyrrolidin-3-yl] carbonate.
| Compound Name | tert-butyl [(3S,4S,5R)-5-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]-4-(4-nitrophenoxy)carbonyloxypyrrolidin-3-yl] carbonate |
|---|---|
| PubChem CID | 176952264 |
| Molecular Formula | C24H30N2O9 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl [(3S,4S,5R)-5-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]-4-(4-nitrophenoxy)carbonyloxypyrrolidin-3-yl] carbonate |
| SMILES | COC1=CCC(C[C@H]2NC[C@H](OC(=O)OC(C)(C)C)[C@H]2OC(=O)Oc2ccc([N+](=O)[O-])cc2)C=C1 |
| InChI | InChI=1S/C24H30N2O9/c1-24(2,3)35-23(28)33-20-14-25-19(13-15-5-9-17(31-4)10-6-15)21(20)34-22(27)32-18-11-7-16(8-12-18)26(29)30/h5,7-12,15,19-21,25H,6,13-14H2,1-4H3/t15?,19-,20+,21+/m1/s1 |
| InChIKey | LLCMIRBERAFFGB-GDSUCZIISA-N |
| XLogP | 4.27 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|