C20H19F2N3O2 — CID 176957039
tert-butyl N-[[5-fluoro-6-(6-fluoro-2-pyridinyl)isoquinolin-3-yl]methyl]carbamate (PubChem CID 176957039) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is tert-butyl N-[[5-fluoro-6-(6-fluoro-2-pyridinyl)isoquinolin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-fluoro-6-(6-fluoro-2-pyridinyl)isoquinolin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176957039 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl N-[[5-fluoro-6-(6-fluoro-2-pyridinyl)isoquinolin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2c(F)c(-c3cccc(F)n3)ccc2cn1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-20(2,3)27-19(26)24-11-13-9-15-12(10-23-13)7-8-14(18(15)22)16-5-4-6-17(21)25-16/h4-10H,11H2,1-3H3,(H,24,26) |
| InChIKey | YCFCRSSWTYSDPX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|