C22H33N2O4+ — CID 176967044
tert-butyl (2S)-2-[3-(4-methylmorpholin-4-ium-4-yl)but-3-enoylamino]-3-phenylpropanoate (PubChem CID 176967044) has the molecular formula C22H33N2O4+ and a molecular weight of 389.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(4-methylmorpholin-4-ium-4-yl)but-3-enoylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[3-(4-methylmorpholin-4-ium-4-yl)but-3-enoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 176967044 |
| Molecular Formula | C22H33N2O4+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | tert-butyl (2S)-2-[3-(4-methylmorpholin-4-ium-4-yl)but-3-enoylamino]-3-phenylpropanoate |
| SMILES | C=C(CC(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C)[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C22H32N2O4/c1-17(24(5)11-13-27-14-12-24)15-20(25)23-19(21(26)28-22(2,3)4)16-18-9-7-6-8-10-18/h6-10,19H,1,11-16H2,2-5H3/p+1/t19-/m0/s1 |
| InChIKey | ZEILFPMNPXBAKB-IBGZPJMESA-O |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|