C23H28F3N7O2 — CID 176970026
1-[4-[nitroso-[(2S)-2-(piperazin-1-ylmethyl)pyrrolidin-1-yl]amino]phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 176970026) has the molecular formula C23H28F3N7O2 and a molecular weight of 491.52 g/mol. Its IUPAC name is 1-[4-[nitroso-[(2S)-2-(piperazin-1-ylmethyl)pyrrolidin-1-yl]amino]phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[nitroso-[(2S)-2-(piperazin-1-ylmethyl)pyrrolidin-1-yl]amino]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 176970026 |
| Molecular Formula | C23H28F3N7O2 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 1-[4-[nitroso-[(2S)-2-(piperazin-1-ylmethyl)pyrrolidin-1-yl]amino]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=NN(c1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)cc1)N1CCC[C@H]1CN1CCNCC1 |
| InChI | InChI=1S/C23H28F3N7O2/c24-23(25,26)17-3-5-18(6-4-17)28-22(34)29-19-7-9-20(10-8-19)33(30-35)32-13-1-2-21(32)16-31-14-11-27-12-15-31/h3-10,21,27H,1-2,11-16H2,(H2,28,29,34)/t21-/m0/s1 |
| InChIKey | KSHPHPIIFXKKPK-NRFANRHFSA-N |
| XLogP | 4.12 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|