C8H11ClN2 — CID 176985229
(4Z)-6-chloro-3-methyliminohepta-1,4,6-trien-2-amine (PubChem CID 176985229) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is (4Z)-6-chloro-3-methyliminohepta-1,4,6-trien-2-amine.
| Compound Name | (4Z)-6-chloro-3-methyliminohepta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 176985229 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (4Z)-6-chloro-3-methyliminohepta-1,4,6-trien-2-amine |
| SMILES | C=C(Cl)/C=C\C(=N\C)C(=C)N |
| InChI | InChI=1S/C8H11ClN2/c1-6(9)4-5-8(11-3)7(2)10/h4-5H,1-2,10H2,3H3/b5-4-,11-8- |
| InChIKey | ZMSZMXGFGWCBQX-YMVJEYMASA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|