About (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride
(E)-4,4-difluoro-3-methylbut-2-enoyl fluoride (PubChem CID 177001675) has the molecular formula C5H5F3O
and a molecular weight of 138.09 g/mol. Its IUPAC name is (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride.
Molecular Properties
| Compound Name | (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride |
| PubChem CID | 177001675 |
| Molecular Formula | C5H5F3O |
| Molecular Weight | 138.09 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride |
| SMILES | C/C(=C\C(=O)F)C(F)F |
| InChI | InChI=1S/C5H5F3O/c1-3(5(7)8)2-4(6)9/h2,5H,1H3/b3-2+ |
| InChIKey | IVJKZJUQKUEEAK-NSCUHMNNSA-N |
| XLogP | 1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride?
The IUPAC name of (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride (CID 177001675) is (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride.
What is the SMILES notation for (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride?
The canonical SMILES for (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride is C/C(=C\C(=O)F)C(F)F.
What is the InChIKey of (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride?
The InChIKey is IVJKZJUQKUEEAK-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H5F3O/c1-3(5(7)8)2-4(6)9/h2,5H,1H3/b3-2+.
What are the key properties of (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride?
(E)-4,4-difluoro-3-methylbut-2-enoyl fluoride has a molecular weight of 138.09 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-difluoro-3-methylbut-2-enoyl fluoride is sourced from PubChem (CID 177001675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).