C14H15BO2S — CID 177002608
1-[4-(1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanethiol (PubChem CID 177002608) has the molecular formula C14H15BO2S and a molecular weight of 258.15 g/mol. Its IUPAC name is 1-[4-(1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanethiol.
| Compound Name | 1-[4-(1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanethiol |
|---|---|
| PubChem CID | 177002608 |
| Molecular Formula | C14H15BO2S |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-[4-(1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanethiol |
| SMILES | CC(S)c1ccc(B2OCCO2)c2ccccc12 |
| InChI | InChI=1S/C14H15BO2S/c1-10(18)11-6-7-14(15-16-8-9-17-15)13-5-3-2-4-12(11)13/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | GVNSWNWHSPBVKH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|