C29H19N6O7+ — CID 177007619
5-(4-methoxyphenyl)-2-(2-nitrophenyl)-3-[3-nitro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,4-oxadiazol-3-ium (PubChem CID 177007619) has the molecular formula C29H19N6O7+ and a molecular weight of 563.51 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(2-nitrophenyl)-3-[3-nitro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,4-oxadiazol-3-ium.
| Compound Name | 5-(4-methoxyphenyl)-2-(2-nitrophenyl)-3-[3-nitro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,4-oxadiazol-3-ium |
|---|---|
| PubChem CID | 177007619 |
| Molecular Formula | C29H19N6O7+ |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(2-nitrophenyl)-3-[3-nitro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,4-oxadiazol-3-ium |
| SMILES | COc1ccc(-c2n[n+](-c3cc(-c4nnc(-c5ccccc5)o4)cc([N+](=O)[O-])c3)c(-c3ccccc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C29H19N6O7/c1-40-23-13-11-19(12-14-23)28-32-33(29(42-28)24-9-5-6-10-25(24)35(38)39)21-15-20(16-22(17-21)34(36)37)27-31-30-26(41-27)18-7-3-2-4-8-18/h2-17H,1H3/q+1 |
| InChIKey | KIIZOYDIIIFVRA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 164.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|