C12H14FNO7S — CID 177010401
3-(3-fluorosulfonyloxy-4-methoxyphenoxy)-2,6-dioxopiperidine;molecular hydrogen (PubChem CID 177010401) has the molecular formula C12H14FNO7S and a molecular weight of 335.31 g/mol. Its IUPAC name is 3-(3-fluorosulfonyloxy-4-methoxyphenoxy)-2,6-dioxopiperidine;molecular hydrogen.
| Compound Name | 3-(3-fluorosulfonyloxy-4-methoxyphenoxy)-2,6-dioxopiperidine;molecular hydrogen |
|---|---|
| PubChem CID | 177010401 |
| Molecular Formula | C12H14FNO7S |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-(3-fluorosulfonyloxy-4-methoxyphenoxy)-2,6-dioxopiperidine;molecular hydrogen |
| SMILES | COc1ccc(OC2CCC(=O)NC2=O)cc1OS(=O)(=O)F.[H][H] |
| InChI | InChI=1S/C12H12FNO7S.H2/c1-19-8-3-2-7(6-10(8)21-22(13,17)18)20-9-4-5-11(15)14-12(9)16;/h2-3,6,9H,4-5H2,1H3,(H,14,15,16);1H |
| InChIKey | UZXSGDJOJIHLSQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|