C16H21FN2O5S — CID 177010953
3-(3-fluorosulfonyloxy-4-pentan-3-ylanilino)-2,6-dioxopiperidine (PubChem CID 177010953) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-(3-fluorosulfonyloxy-4-pentan-3-ylanilino)-2,6-dioxopiperidine.
| Compound Name | 3-(3-fluorosulfonyloxy-4-pentan-3-ylanilino)-2,6-dioxopiperidine |
|---|---|
| PubChem CID | 177010953 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-(3-fluorosulfonyloxy-4-pentan-3-ylanilino)-2,6-dioxopiperidine |
| SMILES | CCC(CC)c1ccc(NC2CCC(=O)NC2=O)cc1OS(=O)(=O)F |
| InChI | InChI=1S/C16H21FN2O5S/c1-3-10(4-2)12-6-5-11(9-14(12)24-25(17,22)23)18-13-7-8-15(20)19-16(13)21/h5-6,9-10,13,18H,3-4,7-8H2,1-2H3,(H,19,20,21) |
| InChIKey | UUEGHSAQVWJPIY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|